C19H30ClN3O — CID 120871709
2-[2-aminoethyl(2-phenylethyl)amino]-N-(dicyclopropylmethyl)acetamide;hydrochloride (PubChem CID 120871709) has the molecular formula C19H30ClN3O and a molecular weight of 351.92 g/mol. Its IUPAC name is 2-[2-aminoethyl(2-phenylethyl)amino]-N-(dicyclopropylmethyl)acetamide;hydrochloride.
| Compound Name | 2-[2-aminoethyl(2-phenylethyl)amino]-N-(dicyclopropylmethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120871709 |
| Molecular Formula | C19H30ClN3O |
| Molecular Weight | 351.92 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 2-[2-aminoethyl(2-phenylethyl)amino]-N-(dicyclopropylmethyl)acetamide;hydrochloride |
| SMILES | Cl.NCCN(CCc1ccccc1)CC(=O)NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C19H29N3O.ClH/c20-11-13-22(12-10-15-4-2-1-3-5-15)14-18(23)21-19(16-6-7-16)17-8-9-17;/h1-5,16-17,19H,6-14,20H2,(H,21,23);1H |
| InChIKey | USYBIVNLZOXZMQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.92 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |