C20H32ClN3O — CID 120871839
2-[2-aminoethyl(2-phenylethyl)amino]-N-cyclopentyl-N-cyclopropylacetamide;hydrochloride (PubChem CID 120871839) has the molecular formula C20H32ClN3O and a molecular weight of 365.95 g/mol. Its IUPAC name is 2-[2-aminoethyl(2-phenylethyl)amino]-N-cyclopentyl-N-cyclopropylacetamide;hydrochloride.
| Compound Name | 2-[2-aminoethyl(2-phenylethyl)amino]-N-cyclopentyl-N-cyclopropylacetamide;hydrochloride |
|---|---|
| PubChem CID | 120871839 |
| Molecular Formula | C20H32ClN3O |
| Molecular Weight | 365.95 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 2-[2-aminoethyl(2-phenylethyl)amino]-N-cyclopentyl-N-cyclopropylacetamide;hydrochloride |
| SMILES | Cl.NCCN(CCc1ccccc1)CC(=O)N(C1CCCC1)C1CC1 |
| InChI | InChI=1S/C20H31N3O.ClH/c21-13-15-22(14-12-17-6-2-1-3-7-17)16-20(24)23(19-10-11-19)18-8-4-5-9-18;/h1-3,6-7,18-19H,4-5,8-16,21H2;1H |
| InChIKey | XTXYPTIFHBZIAC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.95 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |