C17H23ClN2O3 — CID 120871851
2-[[2-aminoethyl(2-phenylethyl)amino]methyl]-5-methoxypyran-4-one;hydrochloride (PubChem CID 120871851) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is 2-[[2-aminoethyl(2-phenylethyl)amino]methyl]-5-methoxypyran-4-one;hydrochloride.
| Compound Name | 2-[[2-aminoethyl(2-phenylethyl)amino]methyl]-5-methoxypyran-4-one;hydrochloride |
|---|---|
| PubChem CID | 120871851 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-[[2-aminoethyl(2-phenylethyl)amino]methyl]-5-methoxypyran-4-one;hydrochloride |
| SMILES | COc1coc(CN(CCN)CCc2ccccc2)cc1=O.Cl |
| InChI | InChI=1S/C17H22N2O3.ClH/c1-21-17-13-22-15(11-16(17)20)12-19(10-8-18)9-7-14-5-3-2-4-6-14;/h2-6,11,13H,7-10,12,18H2,1H3;1H |
| InChIKey | DEFLZBKWDLECEA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |