C18H24N2O3 — CID 120912761
methyl 5-[[2-aminoethyl(2-phenylethyl)amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 120912761) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is methyl 5-[[2-aminoethyl(2-phenylethyl)amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[2-aminoethyl(2-phenylethyl)amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 120912761 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | methyl 5-[[2-aminoethyl(2-phenylethyl)amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CN(CCN)CCc2ccccc2)oc1C |
| InChI | InChI=1S/C18H24N2O3/c1-14-17(18(21)22-2)12-16(23-14)13-20(11-9-19)10-8-15-6-4-3-5-7-15/h3-7,12H,8-11,13,19H2,1-2H3 |
| InChIKey | SWRZQHHKBZUMDO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |