C18H21F2N3O — CID 120871923
2-[2-aminoethyl(2-phenylethyl)amino]-N-(2,5-difluorophenyl)acetamide (PubChem CID 120871923) has the molecular formula C18H21F2N3O and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-[2-aminoethyl(2-phenylethyl)amino]-N-(2,5-difluorophenyl)acetamide.
| Compound Name | 2-[2-aminoethyl(2-phenylethyl)amino]-N-(2,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 120871923 |
| Molecular Formula | C18H21F2N3O |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[2-aminoethyl(2-phenylethyl)amino]-N-(2,5-difluorophenyl)acetamide |
| SMILES | NCCN(CCc1ccccc1)CC(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C18H21F2N3O/c19-15-6-7-16(20)17(12-15)22-18(24)13-23(11-9-21)10-8-14-4-2-1-3-5-14/h1-7,12H,8-11,13,21H2,(H,22,24) |
| InChIKey | HZSSNFOEHWJJTA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |