C14H26ClN3O2S — CID 120872331
N-[2-[2-aminoethyl(2-phenylethyl)amino]ethyl]ethanesulfonamide;hydrochloride (PubChem CID 120872331) has the molecular formula C14H26ClN3O2S and a molecular weight of 335.90 g/mol. Its IUPAC name is N-[2-[2-aminoethyl(2-phenylethyl)amino]ethyl]ethanesulfonamide;hydrochloride.
| Compound Name | N-[2-[2-aminoethyl(2-phenylethyl)amino]ethyl]ethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120872331 |
| Molecular Formula | C14H26ClN3O2S |
| Molecular Weight | 335.90 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-[2-[2-aminoethyl(2-phenylethyl)amino]ethyl]ethanesulfonamide;hydrochloride |
| SMILES | CCS(=O)(=O)NCCN(CCN)CCc1ccccc1.Cl |
| InChI | InChI=1S/C14H25N3O2S.ClH/c1-2-20(18,19)16-10-13-17(12-9-15)11-8-14-6-4-3-5-7-14;/h3-7,16H,2,8-13,15H2,1H3;1H |
| InChIKey | MLRGDUZTESQSEE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.90 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |