C18H33N3O4S — CID 120876158
[3-[2-(aminomethyl)-4-methoxypiperidin-1-yl]sulfonylpiperidin-1-yl]-cyclopentylmethanone (PubChem CID 120876158) has the molecular formula C18H33N3O4S and a molecular weight of 387.55 g/mol. Its IUPAC name is [3-[2-(aminomethyl)-4-methoxypiperidin-1-yl]sulfonylpiperidin-1-yl]-cyclopentylmethanone.
| Compound Name | [3-[2-(aminomethyl)-4-methoxypiperidin-1-yl]sulfonylpiperidin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 120876158 |
| Molecular Formula | C18H33N3O4S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | [3-[2-(aminomethyl)-4-methoxypiperidin-1-yl]sulfonylpiperidin-1-yl]-cyclopentylmethanone |
| SMILES | COC1CCN(S(=O)(=O)C2CCCN(C(=O)C3CCCC3)C2)C(CN)C1 |
| InChI | InChI=1S/C18H33N3O4S/c1-25-16-8-10-21(15(11-16)12-19)26(23,24)17-7-4-9-20(13-17)18(22)14-5-2-3-6-14/h14-17H,2-13,19H2,1H3 |
| InChIKey | PHVGZVQZOBYBRE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |