C13H17N5O2S — CID 120876860
(3S,4R)-1-(3-methyltriazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-amine (PubChem CID 120876860) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is (3S,4R)-1-(3-methyltriazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-(3-methyltriazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120876860 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (3S,4R)-1-(3-methyltriazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-amine |
| SMILES | Cn1nncc1S(=O)(=O)N1C[C@@H](N)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C13H17N5O2S/c1-17-13(7-15-16-17)21(19,20)18-8-11(12(14)9-18)10-5-3-2-4-6-10/h2-7,11-12H,8-9,14H2,1H3/t11-,12+/m0/s1 |
| InChIKey | MYQFBMXYUXWVDT-NWDGAFQWSA-N |
| XLogP | -0.07 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |