C15H16Cl2F2N4O — CID 120878629
(2-chloro-4,5-difluorophenyl)-[2-(1-methylimidazol-2-yl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 120878629) has the molecular formula C15H16Cl2F2N4O and a molecular weight of 377.22 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-[2-(1-methylimidazol-2-yl)piperazin-1-yl]methanone;hydrochloride.
| Compound Name | (2-chloro-4,5-difluorophenyl)-[2-(1-methylimidazol-2-yl)piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120878629 |
| Molecular Formula | C15H16Cl2F2N4O |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-[2-(1-methylimidazol-2-yl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | Cl.Cn1ccnc1C1CNCCN1C(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C15H15ClF2N4O.ClH/c1-21-4-3-20-14(21)13-8-19-2-5-22(13)15(23)9-6-11(17)12(18)7-10(9)16;/h3-4,6-7,13,19H,2,5,8H2,1H3;1H |
| InChIKey | AJWMOPXYYOFRKS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|