C14H23ClN4O2 — CID 120880679
1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-(oxolan-2-yl)ethanone;hydrochloride (PubChem CID 120880679) has the molecular formula C14H23ClN4O2 and a molecular weight of 314.82 g/mol. Its IUPAC name is 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-(oxolan-2-yl)ethanone;hydrochloride.
| Compound Name | 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-(oxolan-2-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120880679 |
| Molecular Formula | C14H23ClN4O2 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-(oxolan-2-yl)ethanone;hydrochloride |
| SMILES | Cl.Cn1ccnc1C1CNCCN1C(=O)CC1CCCO1 |
| InChI | InChI=1S/C14H22N4O2.ClH/c1-17-6-5-16-14(17)12-10-15-4-7-18(12)13(19)9-11-3-2-8-20-11;/h5-6,11-12,15H,2-4,7-10H2,1H3;1H |
| InChIKey | SFHRVWYMHWPDBS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |