C20H21FN4O3 — CID 120881764
N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 120881764) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 120881764 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc2c(c1F)CCNC2)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21FN4O3/c21-19-15-7-8-22-12-14(15)3-5-16(19)23-20(26)13-4-6-17(18(11-13)25(27)28)24-9-1-2-10-24/h3-6,11,22H,1-2,7-10,12H2,(H,23,26) |
| InChIKey | IWITVFGAQDAGRO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|