C13H13FN6O3 — CID 120882278
N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 120882278) has the molecular formula C13H13FN6O3 and a molecular weight of 320.28 g/mol. Its IUPAC name is N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 120882278 |
| Molecular Formula | C13H13FN6O3 |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)Nc1ccc2c(c1F)CCNC2 |
| InChI | InChI=1S/C13H13FN6O3/c14-12-9-3-4-15-5-8(9)1-2-10(12)17-11(21)6-19-7-16-13(18-19)20(22)23/h1-2,7,15H,3-6H2,(H,17,21) |
| InChIKey | KFAPALKAFLLJDF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|