C17H18ClFN4O3S — CID 120884001
N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide;hydrochloride (PubChem CID 120884001) has the molecular formula C17H18ClFN4O3S and a molecular weight of 412.87 g/mol. Its IUPAC name is N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide;hydrochloride.
| Compound Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120884001 |
| Molecular Formula | C17H18ClFN4O3S |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-(5-fluoro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc2c(c1F)CCNC2)C1=CC=CN2CCS(=O)(=O)N=C12 |
| InChI | InChI=1S/C17H17FN4O3S.ClH/c18-15-12-5-6-19-10-11(12)3-4-14(15)20-17(23)13-2-1-7-22-8-9-26(24,25)21-16(13)22;/h1-4,7,19H,5-6,8-10H2,(H,20,23);1H |
| InChIKey | LHRNJRKDMDHBNI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |