C20H23ClN4O2 — CID 120884289
N-(2-aminoethyl)-1-methyl-4-oxo-N-(2-phenylethyl)cinnoline-3-carboxamide;hydrochloride (PubChem CID 120884289) has the molecular formula C20H23ClN4O2 and a molecular weight of 386.88 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-methyl-4-oxo-N-(2-phenylethyl)cinnoline-3-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-methyl-4-oxo-N-(2-phenylethyl)cinnoline-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120884289 |
| Molecular Formula | C20H23ClN4O2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-(2-aminoethyl)-1-methyl-4-oxo-N-(2-phenylethyl)cinnoline-3-carboxamide;hydrochloride |
| SMILES | Cl.Cn1nc(C(=O)N(CCN)CCc2ccccc2)c(=O)c2ccccc21 |
| InChI | InChI=1S/C20H22N4O2.ClH/c1-23-17-10-6-5-9-16(17)19(25)18(22-23)20(26)24(14-12-21)13-11-15-7-3-2-4-8-15;/h2-10H,11-14,21H2,1H3;1H |
| InChIKey | UENFKHQTPWGSLJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |