C22H30N4O2 — CID 120884588
N-(2-aminoethyl)-N-(2-phenylethyl)-4-[(propan-2-ylcarbamoylamino)methyl]benzamide (PubChem CID 120884588) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-(2-phenylethyl)-4-[(propan-2-ylcarbamoylamino)methyl]benzamide.
| Compound Name | N-(2-aminoethyl)-N-(2-phenylethyl)-4-[(propan-2-ylcarbamoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 120884588 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-(2-aminoethyl)-N-(2-phenylethyl)-4-[(propan-2-ylcarbamoylamino)methyl]benzamide |
| SMILES | CC(C)NC(=O)NCc1ccc(C(=O)N(CCN)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H30N4O2/c1-17(2)25-22(28)24-16-19-8-10-20(11-9-19)21(27)26(15-13-23)14-12-18-6-4-3-5-7-18/h3-11,17H,12-16,23H2,1-2H3,(H2,24,25,28) |
| InChIKey | SSEMLCHGEDPKFJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |