C18H24ClN3O3S — CID 120884759
N-(2-aminoethyl)-4-(methanesulfonamido)-N-(2-phenylethyl)benzamide;hydrochloride (PubChem CID 120884759) has the molecular formula C18H24ClN3O3S and a molecular weight of 397.93 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-(methanesulfonamido)-N-(2-phenylethyl)benzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-4-(methanesulfonamido)-N-(2-phenylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120884759 |
| Molecular Formula | C18H24ClN3O3S |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-(2-aminoethyl)-4-(methanesulfonamido)-N-(2-phenylethyl)benzamide;hydrochloride |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)N(CCN)CCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C18H23N3O3S.ClH/c1-25(23,24)20-17-9-7-16(8-10-17)18(22)21(14-12-19)13-11-15-5-3-2-4-6-15;/h2-10,20H,11-14,19H2,1H3;1H |
| InChIKey | YBZJVOYEIIVSJL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |