C17H24N6O2 — CID 120885038
N-(2-aminoethyl)-1-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylethyl)triazole-4-carboxamide (PubChem CID 120885038) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylethyl)triazole-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 120885038 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | N-(2-aminoethyl)-1-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylethyl)triazole-4-carboxamide |
| SMILES | CN(C)C(=O)Cn1cc(C(=O)N(CCN)CCc2ccccc2)nn1 |
| InChI | InChI=1S/C17H24N6O2/c1-21(2)16(24)13-23-12-15(19-20-23)17(25)22(11-9-18)10-8-14-6-4-3-5-7-14/h3-7,12H,8-11,13,18H2,1-2H3 |
| InChIKey | YSTMINPOISJOGJ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |