C19H23ClN4O — CID 120885435
N-(2-aminoethyl)-5-methyl-N-(2-phenylethyl)-1H-indazole-7-carboxamide;hydrochloride (PubChem CID 120885435) has the molecular formula C19H23ClN4O and a molecular weight of 358.87 g/mol. Its IUPAC name is N-(2-aminoethyl)-5-methyl-N-(2-phenylethyl)-1H-indazole-7-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-5-methyl-N-(2-phenylethyl)-1H-indazole-7-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120885435 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-(2-aminoethyl)-5-methyl-N-(2-phenylethyl)-1H-indazole-7-carboxamide;hydrochloride |
| SMILES | Cc1cc(C(=O)N(CCN)CCc2ccccc2)c2[nH]ncc2c1.Cl |
| InChI | InChI=1S/C19H22N4O.ClH/c1-14-11-16-13-21-22-18(16)17(12-14)19(24)23(10-8-20)9-7-15-5-3-2-4-6-15;/h2-6,11-13H,7-10,20H2,1H3,(H,21,22);1H |
| InChIKey | ANGBCWQSBLTRCA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |