C17H27N3O2 — CID 120885712
N-(2-aminoethyl)-4-ethyl-N-(2-phenylethyl)morpholine-2-carboxamide (PubChem CID 120885712) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-ethyl-N-(2-phenylethyl)morpholine-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-4-ethyl-N-(2-phenylethyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 120885712 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | N-(2-aminoethyl)-4-ethyl-N-(2-phenylethyl)morpholine-2-carboxamide |
| SMILES | CCN1CCOC(C(=O)N(CCN)CCc2ccccc2)C1 |
| InChI | InChI=1S/C17H27N3O2/c1-2-19-12-13-22-16(14-19)17(21)20(11-9-18)10-8-15-6-4-3-5-7-15/h3-7,16H,2,8-14,18H2,1H3 |
| InChIKey | ZZXZSIHZQORQQH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |