C20H27ClN2O4S — CID 120885953
N-(2-aminoethyl)-3-(4-methylsulfonylphenoxy)-N-(2-phenylethyl)propanamide;hydrochloride (PubChem CID 120885953) has the molecular formula C20H27ClN2O4S and a molecular weight of 426.97 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-(4-methylsulfonylphenoxy)-N-(2-phenylethyl)propanamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-3-(4-methylsulfonylphenoxy)-N-(2-phenylethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120885953 |
| Molecular Formula | C20H27ClN2O4S |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-(2-aminoethyl)-3-(4-methylsulfonylphenoxy)-N-(2-phenylethyl)propanamide;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(OCCC(=O)N(CCN)CCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C20H26N2O4S.ClH/c1-27(24,25)19-9-7-18(8-10-19)26-16-12-20(23)22(15-13-21)14-11-17-5-3-2-4-6-17;/h2-10H,11-16,21H2,1H3;1H |
| InChIKey | UHVKXGAFKONKPC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |