C20H30N2O4 — CID 120887943
N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide (PubChem CID 120887943) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide.
| Compound Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide |
|---|---|
| PubChem CID | 120887943 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide |
| SMILES | C=CCc1ccc(OCC(=O)NCC2(COC)CCNCC2)c(OC)c1 |
| InChI | InChI=1S/C20H30N2O4/c1-4-5-16-6-7-17(18(12-16)25-3)26-13-19(23)22-14-20(15-24-2)8-10-21-11-9-20/h4,6-7,12,21H,1,5,8-11,13-15H2,2-3H3,(H,22,23) |
| InChIKey | UCRVWWDXUKOMIK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|