C16H19ClN4O2S — CID 120892748
3-[3-[4-(aminomethyl)phenyl]-1,2,4-oxadiazol-5-yl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one;hydrochloride (PubChem CID 120892748) has the molecular formula C16H19ClN4O2S and a molecular weight of 366.87 g/mol. Its IUPAC name is 3-[3-[4-(aminomethyl)phenyl]-1,2,4-oxadiazol-5-yl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one;hydrochloride.
| Compound Name | 3-[3-[4-(aminomethyl)phenyl]-1,2,4-oxadiazol-5-yl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one;hydrochloride |
|---|---|
| PubChem CID | 120892748 |
| Molecular Formula | C16H19ClN4O2S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 3-[3-[4-(aminomethyl)phenyl]-1,2,4-oxadiazol-5-yl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one;hydrochloride |
| SMILES | CC12CCC(=O)N1C(c1nc(-c3ccc(CN)cc3)no1)CS2.Cl |
| InChI | InChI=1S/C16H18N4O2S.ClH/c1-16-7-6-13(21)20(16)12(9-23-16)15-18-14(19-22-15)11-4-2-10(8-17)3-5-11;/h2-5,12H,6-9,17H2,1H3;1H |
| InChIKey | ACTKOAXFLCIWDY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |