About N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide
N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide (PubChem CID 120895810) has the molecular formula C15H21N3O2S2
and a molecular weight of 339.49 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide |
| PubChem CID | 120895810 |
| Molecular Formula | C15H21N3O2S2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(C)c(S(=O)(=O)N(CCN)CCc2ccccc2)s1 |
| InChI | InChI=1S/C15H21N3O2S2/c1-12-15(21-13(2)17-12)22(19,20)18(11-9-16)10-8-14-6-4-3-5-7-14/h3-7H,8-11,16H2,1-2H3 |
| InChIKey | VFOPGKJNDYBLNO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide (CID 120895810) is N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide is Cc1nc(C)c(S(=O)(=O)N(CCN)CCc2ccccc2)s1.
What is the InChIKey of N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide?
The InChIKey is VFOPGKJNDYBLNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O2S2/c1-12-15(21-13(2)17-12)22(19,20)18(11-9-16)10-8-14-6-4-3-5-7-14/h3-7H,8-11,16H2,1-2H3.
What are the key properties of N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide?
N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide has a molecular weight of 339.49 g/mol, XLogP of 1.95, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-2,4-dimethyl-N-(2-phenylethyl)-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 120895810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).