C19H31ClN4O — CID 120898003
N-benzyl-2-[4-[(3-methylpyrrolidin-3-yl)methyl]piperazin-1-yl]acetamide;hydrochloride (PubChem CID 120898003) has the molecular formula C19H31ClN4O and a molecular weight of 366.94 g/mol. Its IUPAC name is N-benzyl-2-[4-[(3-methylpyrrolidin-3-yl)methyl]piperazin-1-yl]acetamide;hydrochloride.
| Compound Name | N-benzyl-2-[4-[(3-methylpyrrolidin-3-yl)methyl]piperazin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120898003 |
| Molecular Formula | C19H31ClN4O |
| Molecular Weight | 366.94 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | N-benzyl-2-[4-[(3-methylpyrrolidin-3-yl)methyl]piperazin-1-yl]acetamide;hydrochloride |
| SMILES | CC1(CN2CCN(CC(=O)NCc3ccccc3)CC2)CCNC1.Cl |
| InChI | InChI=1S/C19H30N4O.ClH/c1-19(7-8-20-15-19)16-23-11-9-22(10-12-23)14-18(24)21-13-17-5-3-2-4-6-17;/h2-6,20H,7-16H2,1H3,(H,21,24);1H |
| InChIKey | IOFRIEHBBXGKHR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.94 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |