C14H23N3OS — CID 120899557
5-[(4-cyclopentyloxypiperidin-1-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 120899557) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is 5-[(4-cyclopentyloxypiperidin-1-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(4-cyclopentyloxypiperidin-1-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 120899557 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 5-[(4-cyclopentyloxypiperidin-1-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(CN2CCC(OC3CCCC3)CC2)s1 |
| InChI | InChI=1S/C14H23N3OS/c15-14-16-9-13(19-14)10-17-7-5-12(6-8-17)18-11-3-1-2-4-11/h9,11-12H,1-8,10H2,(H2,15,16) |
| InChIKey | XVZHZABRWMMHKH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |