C19H32ClN3 — CID 120902348
1-benzyl-N-ethyl-N-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 120902348) has the molecular formula C19H32ClN3 and a molecular weight of 337.94 g/mol. Its IUPAC name is 1-benzyl-N-ethyl-N-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-benzyl-N-ethyl-N-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120902348 |
| Molecular Formula | C19H32ClN3 |
| Molecular Weight | 337.94 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 1-benzyl-N-ethyl-N-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | CCN(CC1(C)CCNC1)C1CCN(Cc2ccccc2)C1.Cl |
| InChI | InChI=1S/C19H31N3.ClH/c1-3-22(16-19(2)10-11-20-15-19)18-9-12-21(14-18)13-17-7-5-4-6-8-17;/h4-8,18,20H,3,9-16H2,1-2H3;1H |
| InChIKey | MZNHWKBUNJISKJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.94 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |