C17H27Cl2N3 — CID 120897569
1-[(3-chlorophenyl)methyl]-4-[(3-methylpyrrolidin-3-yl)methyl]piperazine;hydrochloride (PubChem CID 120897569) has the molecular formula C17H27Cl2N3 and a molecular weight of 344.33 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-4-[(3-methylpyrrolidin-3-yl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(3-chlorophenyl)methyl]-4-[(3-methylpyrrolidin-3-yl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120897569 |
| Molecular Formula | C17H27Cl2N3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-4-[(3-methylpyrrolidin-3-yl)methyl]piperazine;hydrochloride |
| SMILES | CC1(CN2CCN(Cc3cccc(Cl)c3)CC2)CCNC1.Cl |
| InChI | InChI=1S/C17H26ClN3.ClH/c1-17(5-6-19-13-17)14-21-9-7-20(8-10-21)12-15-3-2-4-16(18)11-15;/h2-4,11,19H,5-10,12-14H2,1H3;1H |
| InChIKey | KEYAAWBYCQMECV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |