About 5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride
5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride (PubChem CID 120903083) has the molecular formula C13H16BrClFN3S
and a molecular weight of 380.71 g/mol. Its IUPAC name is 5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride |
| PubChem CID | 120903083 |
| Molecular Formula | C13H16BrClFN3S |
| Molecular Weight | 380.71 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride |
| SMILES | CCN(Cc1cnc(N)s1)Cc1cc(Br)ccc1F.Cl |
| InChI | InChI=1S/C13H15BrFN3S.ClH/c1-2-18(8-11-6-17-13(16)19-11)7-9-5-10(14)3-4-12(9)15;/h3-6H,2,7-8H2,1H3,(H2,16,17);1H |
| InChIKey | JOSPCCJFSSPDKF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.71 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride?
The IUPAC name of 5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride (CID 120903083) is 5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride.
What is the SMILES notation for 5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride?
The canonical SMILES for 5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride is CCN(Cc1cnc(N)s1)Cc1cc(Br)ccc1F.Cl.
What is the InChIKey of 5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride?
The InChIKey is JOSPCCJFSSPDKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrFN3S.ClH/c1-2-18(8-11-6-17-13(16)19-11)7-9-5-10(14)3-4-12(9)15;/h3-6H,2,7-8H2,1H3,(H2,16,17);1H.
What are the key properties of 5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride?
5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride has a molecular weight of 380.71 g/mol, XLogP of 4.07, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(5-bromo-2-fluorophenyl)methyl-ethylamino]methyl]-1,3-thiazol-2-amine;hydrochloride is sourced from PubChem (CID 120903083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).