About 4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide
4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide (PubChem CID 120903889) has the molecular formula C13H23N5OS
and a molecular weight of 297.43 g/mol. Its IUPAC name is 4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide |
| PubChem CID | 120903889 |
| Molecular Formula | C13H23N5OS |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCN(Cc2cnc(N)s2)CC1 |
| InChI | InChI=1S/C13H23N5OS/c1-13(2,3)16-12(19)18-6-4-17(5-7-18)9-10-8-15-11(14)20-10/h8H,4-7,9H2,1-3H3,(H2,14,15)(H,16,19) |
| InChIKey | JOUVFMRZKHUNIL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide?
The IUPAC name of 4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide (CID 120903889) is 4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide.
What is the SMILES notation for 4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide?
The canonical SMILES for 4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide is CC(C)(C)NC(=O)N1CCN(Cc2cnc(N)s2)CC1.
What is the InChIKey of 4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide?
The InChIKey is JOUVFMRZKHUNIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N5OS/c1-13(2,3)16-12(19)18-6-4-17(5-7-18)9-10-8-15-11(14)20-10/h8H,4-7,9H2,1-3H3,(H2,14,15)(H,16,19).
What are the key properties of 4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide?
4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide has a molecular weight of 297.43 g/mol, XLogP of 1.35, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-amino-1,3-thiazol-5-yl)methyl]-N-tert-butylpiperazine-1-carboxamide is sourced from PubChem (CID 120903889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).