C12H21N3S2 — CID 120905195
5-[(2,2-diethylthiomorpholin-4-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 120905195) has the molecular formula C12H21N3S2 and a molecular weight of 271.45 g/mol. Its IUPAC name is 5-[(2,2-diethylthiomorpholin-4-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(2,2-diethylthiomorpholin-4-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 120905195 |
| Molecular Formula | C12H21N3S2 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 5-[(2,2-diethylthiomorpholin-4-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | CCC1(CC)CN(Cc2cnc(N)s2)CCS1 |
| InChI | InChI=1S/C12H21N3S2/c1-3-12(4-2)9-15(5-6-16-12)8-10-7-14-11(13)17-10/h7H,3-6,8-9H2,1-2H3,(H2,13,14) |
| InChIKey | QXUYSJWXPLIJBQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |