C18H24ClN3O — CID 120909162
4-methyl-1-[(3-methyl-4-pyridin-3-yloxyphenyl)methyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 120909162) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is 4-methyl-1-[(3-methyl-4-pyridin-3-yloxyphenyl)methyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | 4-methyl-1-[(3-methyl-4-pyridin-3-yloxyphenyl)methyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120909162 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 4-methyl-1-[(3-methyl-4-pyridin-3-yloxyphenyl)methyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | Cc1cc(CN2CC(C)C(N)C2)ccc1Oc1cccnc1.Cl |
| InChI | InChI=1S/C18H23N3O.ClH/c1-13-8-15(11-21-10-14(2)17(19)12-21)5-6-18(13)22-16-4-3-7-20-9-16;/h3-9,14,17H,10-12,19H2,1-2H3;1H |
| InChIKey | YTDMDKHIRYHJLS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |