About 4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride
4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 120909639) has the molecular formula C11H18ClF3N4
and a molecular weight of 298.74 g/mol. Its IUPAC name is 4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride |
| PubChem CID | 120909639 |
| Molecular Formula | C11H18ClF3N4 |
| Molecular Weight | 298.74 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | CC1CN(Cc2nccn2CC(F)(F)F)CC1N.Cl |
| InChI | InChI=1S/C11H17F3N4.ClH/c1-8-4-17(5-9(8)15)6-10-16-2-3-18(10)7-11(12,13)14;/h2-3,8-9H,4-7,15H2,1H3;1H |
| InChIKey | PCNPEBDTOBFMMM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.74 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride?
The IUPAC name of 4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride (CID 120909639) is 4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride.
What is the SMILES notation for 4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride?
The canonical SMILES for 4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride is CC1CN(Cc2nccn2CC(F)(F)F)CC1N.Cl.
What is the InChIKey of 4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride?
The InChIKey is PCNPEBDTOBFMMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N4.ClH/c1-8-4-17(5-9(8)15)6-10-16-2-3-18(10)7-11(12,13)14;/h2-3,8-9H,4-7,15H2,1H3;1H.
What are the key properties of 4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride?
4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride has a molecular weight of 298.74 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidin-3-amine;hydrochloride is sourced from PubChem (CID 120909639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).