C16H25Cl2N3 — CID 120909794
1-[(2-chloro-6-pyrrolidin-1-ylphenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride (PubChem CID 120909794) has the molecular formula C16H25Cl2N3 and a molecular weight of 330.30 g/mol. Its IUPAC name is 1-[(2-chloro-6-pyrrolidin-1-ylphenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-[(2-chloro-6-pyrrolidin-1-ylphenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120909794 |
| Molecular Formula | C16H25Cl2N3 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-[(2-chloro-6-pyrrolidin-1-ylphenyl)methyl]-4-methylpyrrolidin-3-amine;hydrochloride |
| SMILES | CC1CN(Cc2c(Cl)cccc2N2CCCC2)CC1N.Cl |
| InChI | InChI=1S/C16H24ClN3.ClH/c1-12-9-19(11-15(12)18)10-13-14(17)5-4-6-16(13)20-7-2-3-8-20;/h4-6,12,15H,2-3,7-11,18H2,1H3;1H |
| InChIKey | KVULBYQHMKDUGK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |