C14H17BrClN3S — CID 120910009
1-[(5-bromothiophen-2-yl)methyl]-2-pyridin-4-ylpiperazine;hydrochloride (PubChem CID 120910009) has the molecular formula C14H17BrClN3S and a molecular weight of 374.74 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-2-pyridin-4-ylpiperazine;hydrochloride.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-2-pyridin-4-ylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120910009 |
| Molecular Formula | C14H17BrClN3S |
| Molecular Weight | 374.74 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-2-pyridin-4-ylpiperazine;hydrochloride |
| SMILES | Brc1ccc(CN2CCNCC2c2ccncc2)s1.Cl |
| InChI | InChI=1S/C14H16BrN3S.ClH/c15-14-2-1-12(19-14)10-18-8-7-17-9-13(18)11-3-5-16-6-4-11;/h1-6,13,17H,7-10H2;1H |
| InChIKey | NUZAAQYOEKXXQP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.74 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |