C13H15BrN4S — CID 120910696
5-bromo-2-[(2-pyridin-4-ylpiperazin-1-yl)methyl]-1,3-thiazole (PubChem CID 120910696) has the molecular formula C13H15BrN4S and a molecular weight of 339.26 g/mol. Its IUPAC name is 5-bromo-2-[(2-pyridin-4-ylpiperazin-1-yl)methyl]-1,3-thiazole.
| Compound Name | 5-bromo-2-[(2-pyridin-4-ylpiperazin-1-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 120910696 |
| Molecular Formula | C13H15BrN4S |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 5-bromo-2-[(2-pyridin-4-ylpiperazin-1-yl)methyl]-1,3-thiazole |
| SMILES | Brc1cnc(CN2CCNCC2c2ccncc2)s1 |
| InChI | InChI=1S/C13H15BrN4S/c14-12-8-17-13(19-12)9-18-6-5-16-7-11(18)10-1-3-15-4-2-10/h1-4,8,11,16H,5-7,9H2 |
| InChIKey | FPANZKBEBFKPNR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |