C14H16N4O2S — CID 120910824
1-[(5-nitrothiophen-3-yl)methyl]-2-pyridin-4-ylpiperazine (PubChem CID 120910824) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 1-[(5-nitrothiophen-3-yl)methyl]-2-pyridin-4-ylpiperazine.
| Compound Name | 1-[(5-nitrothiophen-3-yl)methyl]-2-pyridin-4-ylpiperazine |
|---|---|
| PubChem CID | 120910824 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-[(5-nitrothiophen-3-yl)methyl]-2-pyridin-4-ylpiperazine |
| SMILES | O=[N+]([O-])c1cc(CN2CCNCC2c2ccncc2)cs1 |
| InChI | InChI=1S/C14H16N4O2S/c19-18(20)14-7-11(10-21-14)9-17-6-5-16-8-13(17)12-1-3-15-4-2-12/h1-4,7,10,13,16H,5-6,8-9H2 |
| InChIKey | QTVKHEYDXRLCFZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|