C17H25N5OS — CID 120911494
3-amino-N-[[1-[(4-imidazol-1-ylthiophen-2-yl)methyl]piperidin-2-yl]methyl]propanamide (PubChem CID 120911494) has the molecular formula C17H25N5OS and a molecular weight of 347.49 g/mol. Its IUPAC name is 3-amino-N-[[1-[(4-imidazol-1-ylthiophen-2-yl)methyl]piperidin-2-yl]methyl]propanamide.
| Compound Name | 3-amino-N-[[1-[(4-imidazol-1-ylthiophen-2-yl)methyl]piperidin-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 120911494 |
| Molecular Formula | C17H25N5OS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 3-amino-N-[[1-[(4-imidazol-1-ylthiophen-2-yl)methyl]piperidin-2-yl]methyl]propanamide |
| SMILES | NCCC(=O)NCC1CCCCN1Cc1cc(-n2ccnc2)cs1 |
| InChI | InChI=1S/C17H25N5OS/c18-5-4-17(23)20-10-14-3-1-2-7-21(14)11-16-9-15(12-24-16)22-8-6-19-13-22/h6,8-9,12-14H,1-5,7,10-11,18H2,(H,20,23) |
| InChIKey | SACIQKAQZFRGSR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |