C14H24ClN3OS — CID 120910961
3-amino-N-[[1-(thiophen-3-ylmethyl)piperidin-2-yl]methyl]propanamide;hydrochloride (PubChem CID 120910961) has the molecular formula C14H24ClN3OS and a molecular weight of 317.89 g/mol. Its IUPAC name is 3-amino-N-[[1-(thiophen-3-ylmethyl)piperidin-2-yl]methyl]propanamide;hydrochloride.
| Compound Name | 3-amino-N-[[1-(thiophen-3-ylmethyl)piperidin-2-yl]methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120910961 |
| Molecular Formula | C14H24ClN3OS |
| Molecular Weight | 317.89 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3-amino-N-[[1-(thiophen-3-ylmethyl)piperidin-2-yl]methyl]propanamide;hydrochloride |
| SMILES | Cl.NCCC(=O)NCC1CCCCN1Cc1ccsc1 |
| InChI | InChI=1S/C14H23N3OS.ClH/c15-6-4-14(18)16-9-13-3-1-2-7-17(13)10-12-5-8-19-11-12;/h5,8,11,13H,1-4,6-7,9-10,15H2,(H,16,18);1H |
| InChIKey | JKZXAUTZKGWZPO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.89 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |