C16H25BrClN3O — CID 120581348
3-amino-N-[[1-[(2-bromophenyl)methyl]piperidin-2-yl]methyl]propanamide;hydrochloride (PubChem CID 120581348) has the molecular formula C16H25BrClN3O and a molecular weight of 390.75 g/mol. Its IUPAC name is 3-amino-N-[[1-[(2-bromophenyl)methyl]piperidin-2-yl]methyl]propanamide;hydrochloride.
| Compound Name | 3-amino-N-[[1-[(2-bromophenyl)methyl]piperidin-2-yl]methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120581348 |
| Molecular Formula | C16H25BrClN3O |
| Molecular Weight | 390.75 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 3-amino-N-[[1-[(2-bromophenyl)methyl]piperidin-2-yl]methyl]propanamide;hydrochloride |
| SMILES | Cl.NCCC(=O)NCC1CCCCN1Cc1ccccc1Br |
| InChI | InChI=1S/C16H24BrN3O.ClH/c17-15-7-2-1-5-13(15)12-20-10-4-3-6-14(20)11-19-16(21)8-9-18;/h1-2,5,7,14H,3-4,6,8-12,18H2,(H,19,21);1H |
| InChIKey | USKGDEUAWMCUGT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.75 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |