C16H23ClFN3O — CID 120910902
3-amino-N-[[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-2-yl]methyl]propanamide (PubChem CID 120910902) has the molecular formula C16H23ClFN3O and a molecular weight of 327.83 g/mol. Its IUPAC name is 3-amino-N-[[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-2-yl]methyl]propanamide.
| Compound Name | 3-amino-N-[[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 120910902 |
| Molecular Formula | C16H23ClFN3O |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 3-amino-N-[[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-2-yl]methyl]propanamide |
| SMILES | NCCC(=O)NCC1CCCCN1Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C16H23ClFN3O/c17-14-6-3-4-12(16(14)18)11-21-9-2-1-5-13(21)10-20-15(22)7-8-19/h3-4,6,13H,1-2,5,7-11,19H2,(H,20,22) |
| InChIKey | KRPVFHSJCWJKCF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |