C16H24Cl2N4O3 — CID 120910957
3-amino-N-[[1-[(4-chloro-3-nitrophenyl)methyl]piperidin-2-yl]methyl]propanamide;hydrochloride (PubChem CID 120910957) has the molecular formula C16H24Cl2N4O3 and a molecular weight of 391.30 g/mol. Its IUPAC name is 3-amino-N-[[1-[(4-chloro-3-nitrophenyl)methyl]piperidin-2-yl]methyl]propanamide;hydrochloride.
| Compound Name | 3-amino-N-[[1-[(4-chloro-3-nitrophenyl)methyl]piperidin-2-yl]methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120910957 |
| Molecular Formula | C16H24Cl2N4O3 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-amino-N-[[1-[(4-chloro-3-nitrophenyl)methyl]piperidin-2-yl]methyl]propanamide;hydrochloride |
| SMILES | Cl.NCCC(=O)NCC1CCCCN1Cc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H23ClN4O3.ClH/c17-14-5-4-12(9-15(14)21(23)24)11-20-8-2-1-3-13(20)10-19-16(22)6-7-18;/h4-5,9,13H,1-3,6-8,10-11,18H2,(H,19,22);1H |
| InChIKey | NLNIGKZWDHBKMD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|