C18H30ClN3O2 — CID 120911453
3-amino-N-[[1-[(3-ethoxyphenyl)methyl]piperidin-2-yl]methyl]propanamide;hydrochloride (PubChem CID 120911453) has the molecular formula C18H30ClN3O2 and a molecular weight of 355.91 g/mol. Its IUPAC name is 3-amino-N-[[1-[(3-ethoxyphenyl)methyl]piperidin-2-yl]methyl]propanamide;hydrochloride.
| Compound Name | 3-amino-N-[[1-[(3-ethoxyphenyl)methyl]piperidin-2-yl]methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120911453 |
| Molecular Formula | C18H30ClN3O2 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 3-amino-N-[[1-[(3-ethoxyphenyl)methyl]piperidin-2-yl]methyl]propanamide;hydrochloride |
| SMILES | CCOc1cccc(CN2CCCCC2CNC(=O)CCN)c1.Cl |
| InChI | InChI=1S/C18H29N3O2.ClH/c1-2-23-17-8-5-6-15(12-17)14-21-11-4-3-7-16(21)13-20-18(22)9-10-19;/h5-6,8,12,16H,2-4,7,9-11,13-14,19H2,1H3,(H,20,22);1H |
| InChIKey | FJQFJVKEPNMFQF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |