C17H27N3O3 — CID 120911276
3-amino-N-[[1-[(3-hydroxy-2-methoxyphenyl)methyl]piperidin-2-yl]methyl]propanamide (PubChem CID 120911276) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-amino-N-[[1-[(3-hydroxy-2-methoxyphenyl)methyl]piperidin-2-yl]methyl]propanamide.
| Compound Name | 3-amino-N-[[1-[(3-hydroxy-2-methoxyphenyl)methyl]piperidin-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 120911276 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 3-amino-N-[[1-[(3-hydroxy-2-methoxyphenyl)methyl]piperidin-2-yl]methyl]propanamide |
| SMILES | COc1c(O)cccc1CN1CCCCC1CNC(=O)CCN |
| InChI | InChI=1S/C17H27N3O3/c1-23-17-13(5-4-7-15(17)21)12-20-10-3-2-6-14(20)11-19-16(22)8-9-18/h4-5,7,14,21H,2-3,6,8-12,18H2,1H3,(H,19,22) |
| InChIKey | MXTNELRXGPBGIJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |