C17H25ClN4S — CID 120911795
1-[(3-ethylsulfanylphenyl)methyl]-2-(1-methylimidazol-2-yl)piperazine;hydrochloride (PubChem CID 120911795) has the molecular formula C17H25ClN4S and a molecular weight of 352.94 g/mol. Its IUPAC name is 1-[(3-ethylsulfanylphenyl)methyl]-2-(1-methylimidazol-2-yl)piperazine;hydrochloride.
| Compound Name | 1-[(3-ethylsulfanylphenyl)methyl]-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120911795 |
| Molecular Formula | C17H25ClN4S |
| Molecular Weight | 352.94 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[(3-ethylsulfanylphenyl)methyl]-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
| SMILES | CCSc1cccc(CN2CCNCC2c2nccn2C)c1.Cl |
| InChI | InChI=1S/C17H24N4S.ClH/c1-3-22-15-6-4-5-14(11-15)13-21-10-7-18-12-16(21)17-19-8-9-20(17)2;/h4-6,8-9,11,16,18H,3,7,10,12-13H2,1-2H3;1H |
| InChIKey | ZEWHRQDJDRVIQT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.94 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |