C12H12Cl2N4O2 — CID 120913278
2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methylamino]propanoic acid (PubChem CID 120913278) has the molecular formula C12H12Cl2N4O2 and a molecular weight of 315.16 g/mol. Its IUPAC name is 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methylamino]propanoic acid.
| Compound Name | 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 120913278 |
| Molecular Formula | C12H12Cl2N4O2 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 2-[[1-(2,3-dichlorophenyl)triazol-4-yl]methylamino]propanoic acid |
| SMILES | CC(NCc1cn(-c2cccc(Cl)c2Cl)nn1)C(=O)O |
| InChI | InChI=1S/C12H12Cl2N4O2/c1-7(12(19)20)15-5-8-6-18(17-16-8)10-4-2-3-9(13)11(10)14/h2-4,6-7,15H,5H2,1H3,(H,19,20) |
| InChIKey | ORSUTOMSHZXGNV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |