C10H10Cl2N4 — CID 114419272
1-[1-(2,3-dichlorophenyl)triazol-4-yl]ethanamine (PubChem CID 114419272) has the molecular formula C10H10Cl2N4 and a molecular weight of 257.12 g/mol. Its IUPAC name is 1-[1-(2,3-dichlorophenyl)triazol-4-yl]ethanamine.
| Compound Name | 1-[1-(2,3-dichlorophenyl)triazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 114419272 |
| Molecular Formula | C10H10Cl2N4 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 1-[1-(2,3-dichlorophenyl)triazol-4-yl]ethanamine |
| SMILES | CC(N)c1cn(-c2cccc(Cl)c2Cl)nn1 |
| InChI | InChI=1S/C10H10Cl2N4/c1-6(13)8-5-16(15-14-8)9-4-2-3-7(11)10(9)12/h2-6H,13H2,1H3 |
| InChIKey | ULYGURQQJQEIMP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |