C9H9Cl2N5 — CID 103084945
1-[1-(2,3-dichlorophenyl)tetrazol-5-yl]ethanamine (PubChem CID 103084945) has the molecular formula C9H9Cl2N5 and a molecular weight of 258.11 g/mol. Its IUPAC name is 1-[1-(2,3-dichlorophenyl)tetrazol-5-yl]ethanamine.
| Compound Name | 1-[1-(2,3-dichlorophenyl)tetrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103084945 |
| Molecular Formula | C9H9Cl2N5 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 1-[1-(2,3-dichlorophenyl)tetrazol-5-yl]ethanamine |
| SMILES | CC(N)c1nnnn1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H9Cl2N5/c1-5(12)9-13-14-15-16(9)7-4-2-3-6(10)8(7)11/h2-5H,12H2,1H3 |
| InChIKey | HOVJNHROSRXMSA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |