C16H15Cl2N5O — CID 68583696
1-(2,3-dichlorophenyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]tetrazol-5-amine (PubChem CID 68583696) has the molecular formula C16H15Cl2N5O and a molecular weight of 364.24 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]tetrazol-5-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 68583696 |
| Molecular Formula | C16H15Cl2N5O |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]tetrazol-5-amine |
| SMILES | COc1cccc([C@@H](C)Nc2nnnn2-c2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C16H15Cl2N5O/c1-10(11-5-3-6-12(9-11)24-2)19-16-20-21-22-23(16)14-8-4-7-13(17)15(14)18/h3-10H,1-2H3,(H,19,20,22)/t10-/m1/s1 |
| InChIKey | ZZQOZYCBRNYLGR-SNVBAGLBSA-N |
| XLogP | 4.15 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |