C15H14ClN5 — CID 42909642
N-[1-(3-chlorophenyl)ethyl]-1-phenyltetrazol-5-amine (PubChem CID 42909642) has the molecular formula C15H14ClN5 and a molecular weight of 299.77 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-1-phenyltetrazol-5-amine.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-1-phenyltetrazol-5-amine |
|---|---|
| PubChem CID | 42909642 |
| Molecular Formula | C15H14ClN5 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-1-phenyltetrazol-5-amine |
| SMILES | CC(Nc1nnnn1-c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H14ClN5/c1-11(12-6-5-7-13(16)10-12)17-15-18-19-20-21(15)14-8-3-2-4-9-14/h2-11H,1H3,(H,17,18,20) |
| InChIKey | NVHRLXQIZOZQMD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |