C16H24N2O5 — CID 120913356
(2R)-2-[bis(2-methoxyethyl)carbamoylamino]-3-phenylpropanoic acid (PubChem CID 120913356) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is (2R)-2-[bis(2-methoxyethyl)carbamoylamino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[bis(2-methoxyethyl)carbamoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 120913356 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (2R)-2-[bis(2-methoxyethyl)carbamoylamino]-3-phenylpropanoic acid |
| SMILES | COCCN(CCOC)C(=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H24N2O5/c1-22-10-8-18(9-11-23-2)16(21)17-14(15(19)20)12-13-6-4-3-5-7-13/h3-7,14H,8-12H2,1-2H3,(H,17,21)(H,19,20)/t14-/m1/s1 |
| InChIKey | XCHKAZWCOAGZGV-CQSZACIVSA-N |
| XLogP | 0.99 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |